C18H21ClIN5OS — CID 111612506
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[(5-ethylthiophen-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111612506) has the molecular formula C18H21ClIN5OS and a molecular weight of 517.82 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[(5-ethylthiophen-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[(5-ethylthiophen-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111612506 |
| Molecular Formula | C18H21ClIN5OS |
| Molecular Weight | 517.82 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[(5-ethylthiophen-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1ccc(CN/C(=N\C)NCc2nc(-c3cccc(Cl)c3)no2)s1.I |
| InChI | InChI=1S/C18H20ClN5OS.HI/c1-3-14-7-8-15(26-14)10-21-18(20-2)22-11-16-23-17(24-25-16)12-5-4-6-13(19)9-12;/h4-9H,3,10-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | FQUHWXNAFVPHRJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|