C19H25ClIN7O — CID 111612510
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111612510) has the molecular formula C19H25ClIN7O and a molecular weight of 529.81 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111612510 |
| Molecular Formula | C19H25ClIN7O |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1nc(-c2cccc(Cl)c2)no1.I |
| InChI | InChI=1S/C19H24ClN7O.HI/c1-13-10-14(2)27(25-13)9-5-8-22-19(21-3)23-12-17-24-18(26-28-17)15-6-4-7-16(20)11-15;/h4,6-7,10-11H,5,8-9,12H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | YCMDWFOYKFKPJE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|