C17H19ClN6O — CID 119160491
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-cyanocyclopentyl)-2-methylguanidine (PubChem CID 119160491) has the molecular formula C17H19ClN6O and a molecular weight of 358.83 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-cyanocyclopentyl)-2-methylguanidine.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-cyanocyclopentyl)-2-methylguanidine |
|---|---|
| PubChem CID | 119160491 |
| Molecular Formula | C17H19ClN6O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-cyanocyclopentyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1nc(-c2cccc(Cl)c2)no1)NC1CCCC1C#N |
| InChI | InChI=1S/C17H19ClN6O/c1-20-17(22-14-7-3-5-12(14)9-19)21-10-15-23-16(24-25-15)11-4-2-6-13(18)8-11/h2,4,6,8,12,14H,3,5,7,10H2,1H3,(H2,20,21,22) |
| InChIKey | UFTUEGBEERIDAE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|