C16H25N5O — CID 119160515
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(2-cyanocyclopentyl)-2-methylguanidine (PubChem CID 119160515) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(2-cyanocyclopentyl)-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(2-cyanocyclopentyl)-2-methylguanidine |
|---|---|
| PubChem CID | 119160515 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(2-cyanocyclopentyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NC1CCCC1C#N |
| InChI | InChI=1S/C16H25N5O/c1-16(2,3)13-9-19-14(22-13)10-20-15(18-4)21-12-7-5-6-11(12)8-17/h9,11-12H,5-7,10H2,1-4H3,(H2,18,20,21) |
| InChIKey | CCHZZKPEJGIRFH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|