C14H25IN4O — CID 119155538
1-(2-cyanocyclopentyl)-3-[(2-hydroxycyclopentyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 119155538) has the molecular formula C14H25IN4O and a molecular weight of 392.29 g/mol. Its IUPAC name is 1-(2-cyanocyclopentyl)-3-[(2-hydroxycyclopentyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-cyanocyclopentyl)-3-[(2-hydroxycyclopentyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119155538 |
| Molecular Formula | C14H25IN4O |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-(2-cyanocyclopentyl)-3-[(2-hydroxycyclopentyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCCC1O)NC1CCCC1C#N.I |
| InChI | InChI=1S/C14H24N4O.HI/c1-16-14(17-9-11-5-3-7-13(11)19)18-12-6-2-4-10(12)8-15;/h10-13,19H,2-7,9H2,1H3,(H2,16,17,18);1H |
| InChIKey | RLLNPWGMYYKNLL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|