C11H19N3O — CID 119155581
1-[(2-hydroxycyclopentyl)methyl]-2-methyl-3-prop-2-ynylguanidine (PubChem CID 119155581) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-[(2-hydroxycyclopentyl)methyl]-2-methyl-3-prop-2-ynylguanidine.
| Compound Name | 1-[(2-hydroxycyclopentyl)methyl]-2-methyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 119155581 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-[(2-hydroxycyclopentyl)methyl]-2-methyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N\C)NCC1CCCC1O |
| InChI | InChI=1S/C11H19N3O/c1-3-7-13-11(12-2)14-8-9-5-4-6-10(9)15/h1,9-10,15H,4-8H2,2H3,(H2,12,13,14) |
| InChIKey | CGHNZLUOWRGNJH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|