C7H15NO — CID 13133890
cis-(1S,2R)-2-(methylaminomethyl)cyclopentan-1-ol (PubChem CID 13133890) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is cis-(1S,2R)-2-(methylaminomethyl)cyclopentan-1-ol.
| Compound Name | cis-(1S,2R)-2-(methylaminomethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 13133890 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | cis-(1S,2R)-2-(methylaminomethyl)cyclopentan-1-ol |
| SMILES | CNC[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C7H15NO/c1-8-5-6-3-2-4-7(6)9/h6-9H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | GQIAIEOURDZWHB-RQJHMYQMSA-N |
| XLogP | 0.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |