C16H30N4O3 — CID 119155203
1-[(2-hydroxycyclopentyl)methyl]-3-[1-(2-methoxyacetyl)piperidin-4-yl]-2-methylguanidine (PubChem CID 119155203) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(2-hydroxycyclopentyl)methyl]-3-[1-(2-methoxyacetyl)piperidin-4-yl]-2-methylguanidine.
| Compound Name | 1-[(2-hydroxycyclopentyl)methyl]-3-[1-(2-methoxyacetyl)piperidin-4-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 119155203 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 1-[(2-hydroxycyclopentyl)methyl]-3-[1-(2-methoxyacetyl)piperidin-4-yl]-2-methylguanidine |
| SMILES | C/N=C(\NCC1CCCC1O)NC1CCN(C(=O)COC)CC1 |
| InChI | InChI=1S/C16H30N4O3/c1-17-16(18-10-12-4-3-5-14(12)21)19-13-6-8-20(9-7-13)15(22)11-23-2/h12-14,21H,3-11H2,1-2H3,(H2,17,18,19) |
| InChIKey | CODZFYUQFAAHRZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|