C15H28N4O3 — CID 119156095
1-[(1-hydroxycyclobutyl)methyl]-3-[1-(2-methoxyacetyl)piperidin-4-yl]-2-methylguanidine (PubChem CID 119156095) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[(1-hydroxycyclobutyl)methyl]-3-[1-(2-methoxyacetyl)piperidin-4-yl]-2-methylguanidine.
| Compound Name | 1-[(1-hydroxycyclobutyl)methyl]-3-[1-(2-methoxyacetyl)piperidin-4-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 119156095 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-[(1-hydroxycyclobutyl)methyl]-3-[1-(2-methoxyacetyl)piperidin-4-yl]-2-methylguanidine |
| SMILES | C/N=C(\NCC1(O)CCC1)NC1CCN(C(=O)COC)CC1 |
| InChI | InChI=1S/C15H28N4O3/c1-16-14(17-11-15(21)6-3-7-15)18-12-4-8-19(9-5-12)13(20)10-22-2/h12,21H,3-11H2,1-2H3,(H2,16,17,18) |
| InChIKey | KEKJZTJFBMMDIE-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|