C21H41IN6O2 — CID 111992948
methyl 4-[[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111992948) has the molecular formula C21H41IN6O2 and a molecular weight of 536.50 g/mol. Its IUPAC name is methyl 4-[[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | methyl 4-[[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111992948 |
| Molecular Formula | C21H41IN6O2 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | methyl 4-[[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCC1(N2CCCCC2)CCN(C)CC1)NC1CCN(C(=O)OC)CC1.I |
| InChI | InChI=1S/C21H40N6O2.HI/c1-22-19(24-18-7-13-26(14-8-18)20(28)29-3)23-17-21(9-15-25(2)16-10-21)27-11-5-4-6-12-27;/h18H,4-17H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | JIXSTHRRHHJCEC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|