C24H47IN6O — CID 111993882
3-[[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide;hydroiodide (PubChem CID 111993882) has the molecular formula C24H47IN6O and a molecular weight of 562.59 g/mol. Its IUPAC name is 3-[[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide;hydroiodide.
| Compound Name | 3-[[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111993882 |
| Molecular Formula | C24H47IN6O |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 3-[[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCC1(N2CCCCC2)CCN(C)CC1)NC1CCCC(C(=O)NC(C)C)C1.I |
| InChI | InChI=1S/C24H46N6O.HI/c1-19(2)27-22(31)20-9-8-10-21(17-20)28-23(25-3)26-18-24(11-15-29(4)16-12-24)30-13-6-5-7-14-30;/h19-21H,5-18H2,1-4H3,(H,27,31)(H2,25,26,28);1H |
| InChIKey | GHIFGLHIXNDZJH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|