C21H41N5S — CID 111997289
1-(3-ethylsulfanylcyclopentyl)-2-methyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine (PubChem CID 111997289) has the molecular formula C21H41N5S and a molecular weight of 395.66 g/mol. Its IUPAC name is 1-(3-ethylsulfanylcyclopentyl)-2-methyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-(3-ethylsulfanylcyclopentyl)-2-methyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111997289 |
| Molecular Formula | C21H41N5S |
| Molecular Weight | 395.66 g/mol |
| Exact Mass | 395.31 |
| IUPAC Name | 1-(3-ethylsulfanylcyclopentyl)-2-methyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine |
| SMILES | CCSC1CCC(N/C(=N\C)NCC2(N3CCCCC3)CCN(C)CC2)C1 |
| InChI | InChI=1S/C21H41N5S/c1-4-27-19-9-8-18(16-19)24-20(22-2)23-17-21(10-14-25(3)15-11-21)26-12-6-5-7-13-26/h18-19H,4-17H2,1-3H3,(H2,22,23,24) |
| InChIKey | GIOIIEPBIWPSAC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|