C20H27IN6 — CID 119157221
1-(2-cyanocyclopentyl)-3-[[2-(dimethylamino)quinolin-4-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 119157221) has the molecular formula C20H27IN6 and a molecular weight of 478.38 g/mol. Its IUPAC name is 1-(2-cyanocyclopentyl)-3-[[2-(dimethylamino)quinolin-4-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-cyanocyclopentyl)-3-[[2-(dimethylamino)quinolin-4-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119157221 |
| Molecular Formula | C20H27IN6 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 1-(2-cyanocyclopentyl)-3-[[2-(dimethylamino)quinolin-4-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(N(C)C)nc2ccccc12)NC1CCCC1C#N.I |
| InChI | InChI=1S/C20H26N6.HI/c1-22-20(25-17-10-6-7-14(17)12-21)23-13-15-11-19(26(2)3)24-18-9-5-4-8-16(15)18;/h4-5,8-9,11,14,17H,6-7,10,13H2,1-3H3,(H2,22,23,25);1H |
| InChIKey | WSLJAIBMNLBZHA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|