C23H39IN6 — CID 111771393
1-[5-(diethylamino)pentan-2-yl]-3-[[2-(dimethylamino)quinolin-4-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111771393) has the molecular formula C23H39IN6 and a molecular weight of 526.51 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[[2-(dimethylamino)quinolin-4-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[2-(dimethylamino)quinolin-4-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111771393 |
| Molecular Formula | C23H39IN6 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[2-(dimethylamino)quinolin-4-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCc1cc(N(C)C)nc2ccccc12.I |
| InChI | InChI=1S/C23H38N6.HI/c1-7-29(8-2)15-11-12-18(3)26-23(24-4)25-17-19-16-22(28(5)6)27-21-14-10-9-13-20(19)21;/h9-10,13-14,16,18H,7-8,11-12,15,17H2,1-6H3,(H2,24,25,26);1H |
| InChIKey | QJCCOIJEWNPXMU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|