C22H34IN5O2 — CID 111595425
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[(6-cyclohexyloxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111595425) has the molecular formula C22H34IN5O2 and a molecular weight of 527.45 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[(6-cyclohexyloxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[(6-cyclohexyloxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111595425 |
| Molecular Formula | C22H34IN5O2 |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[(6-cyclohexyloxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC2CCCCC2)nc1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C22H33N5O2.HI/c1-22(2,3)18-14-25-20(29-18)15-27-21(23-4)26-13-16-10-11-19(24-12-16)28-17-8-6-5-7-9-17;/h10-12,14,17H,5-9,13,15H2,1-4H3,(H2,23,26,27);1H |
| InChIKey | RFLKMOVKGHTBQP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|