C21H32IN5O2 — CID 111595209
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111595209) has the molecular formula C21H32IN5O2 and a molecular weight of 513.42 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111595209 |
| Molecular Formula | C21H32IN5O2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCc1cccnc1OC1CCCC1.I |
| InChI | InChI=1S/C21H31N5O2.HI/c1-21(2,3)17-13-24-18(28-17)14-26-20(22-4)25-12-15-8-7-11-23-19(15)27-16-9-5-6-10-16;/h7-8,11,13,16H,5-6,9-10,12,14H2,1-4H3,(H2,22,25,26);1H |
| InChIKey | WEWRATSMXAJDIP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|