C16H27N5O3 — CID 111785074
ethyl 4-[[N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111785074) has the molecular formula C16H27N5O3 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl 4-[[N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111785074 |
| Molecular Formula | C16H27N5O3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | ethyl 4-[[N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCc2cc(CC)no2)CC1 |
| InChI | InChI=1S/C16H27N5O3/c1-4-12-10-14(24-20-12)11-18-15(17-3)19-13-6-8-21(9-7-13)16(22)23-5-2/h10,13H,4-9,11H2,1-3H3,(H2,17,18,19) |
| InChIKey | IAERJZOKVANUKI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|