C20H31N5O4 — CID 111329544
ethyl 4-[[N-[2-[(3-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111329544) has the molecular formula C20H31N5O4 and a molecular weight of 405.50 g/mol. Its IUPAC name is ethyl 4-[[N-[2-[(3-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-[2-[(3-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111329544 |
| Molecular Formula | C20H31N5O4 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | ethyl 4-[[N-[2-[(3-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCNC(=O)c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C20H31N5O4/c1-4-29-20(27)25-12-8-16(9-13-25)24-19(21-2)23-11-10-22-18(26)15-6-5-7-17(14-15)28-3/h5-7,14,16H,4,8-13H2,1-3H3,(H,22,26)(H2,21,23,24) |
| InChIKey | FIMYCADYJJEMOQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|