C15H30N4O4 — CID 111327660
ethyl 4-[[N-[2-(2-methoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111327660) has the molecular formula C15H30N4O4 and a molecular weight of 330.43 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(2-methoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-[2-(2-methoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111327660 |
| Molecular Formula | C15H30N4O4 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | ethyl 4-[[N-[2-(2-methoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCOCCOC)CC1 |
| InChI | InChI=1S/C15H30N4O4/c1-4-23-15(20)19-8-5-13(6-9-19)18-14(16-2)17-7-10-22-12-11-21-3/h13H,4-12H2,1-3H3,(H2,16,17,18) |
| InChIKey | KEVPIBPDSBJHCL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|