C19H19F4IN4 — CID 111889892
2-[(3-cyanophenyl)methyl]-1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111889892) has the molecular formula C19H19F4IN4 and a molecular weight of 506.29 g/mol. Its IUPAC name is 2-[(3-cyanophenyl)methyl]-1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3-cyanophenyl)methyl]-1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111889892 |
| Molecular Formula | C19H19F4IN4 |
| Molecular Weight | 506.29 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 2-[(3-cyanophenyl)methyl]-1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C#N)c1)NCc1ccc(F)cc1C(F)(F)F.I |
| InChI | InChI=1S/C19H18F4N4.HI/c1-2-25-18(26-11-14-5-3-4-13(8-14)10-24)27-12-15-6-7-16(20)9-17(15)19(21,22)23;/h3-9H,2,11-12H2,1H3,(H2,25,26,27);1H |
| InChIKey | KWKBJEINGCESPH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|