C21H39N7O — CID 111652558
1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111652558) has the molecular formula C21H39N7O and a molecular weight of 405.59 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111652558 |
| Molecular Formula | C21H39N7O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCN(C)CC1)NCCN(C)CCCOC |
| InChI | InChI=1S/C21H39N7O/c1-5-22-21(24-10-12-26(2)11-7-17-29-4)25-18-19-8-6-9-23-20(19)28-15-13-27(3)14-16-28/h6,8-9H,5,7,10-18H2,1-4H3,(H2,22,24,25) |
| InChIKey | ZDUUWBBKQCNUID-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|