C24H32FN5O — CID 111625302
1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine (PubChem CID 111625302) has the molecular formula C24H32FN5O and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111625302 |
| Molecular Formula | C24H32FN5O |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCNC(=O)C2)cc1)NCC(C)(C)c1cccc(F)c1 |
| InChI | InChI=1S/C24H32FN5O/c1-4-26-23(29-17-24(2,3)19-6-5-7-20(25)14-19)28-15-18-8-10-21(11-9-18)30-13-12-27-22(31)16-30/h5-11,14H,4,12-13,15-17H2,1-3H3,(H,27,31)(H2,26,28,29) |
| InChIKey | PBJVLGQPLUNYHO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|