C24H38IN5O2 — CID 111570656
1-[[[N-ethyl-N'-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111570656) has the molecular formula C24H38IN5O2 and a molecular weight of 555.51 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[N-ethyl-N'-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111570656 |
| Molecular Formula | C24H38IN5O2 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | 1-[[[N-ethyl-N'-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2=O)cc1)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C24H37N5O2.HI/c1-4-25-23(27-18-24(13-5-6-14-24)22(31)28(2)3)26-16-19-9-11-20(12-10-19)17-29-15-7-8-21(29)30;/h9-12H,4-8,13-18H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | IREYBRBGQRPMOP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|