C16H34IN5O3 — CID 111658919
2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-propylacetamide;hydroiodide (PubChem CID 111658919) has the molecular formula C16H34IN5O3 and a molecular weight of 471.38 g/mol. Its IUPAC name is 2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-propylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-propylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111658919 |
| Molecular Formula | C16H34IN5O3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-propylacetamide;hydroiodide |
| SMILES | CCCNC(=O)C/N=C(\NCC)NCC(C)(O)CN1CCOCC1.I |
| InChI | InChI=1S/C16H33N5O3.HI/c1-4-6-18-14(22)11-19-15(17-5-2)20-12-16(3,23)13-21-7-9-24-10-8-21;/h23H,4-13H2,1-3H3,(H,18,22)(H2,17,19,20);1H |
| InChIKey | LWRLNFXCRWEVOE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|