C17H36IN5O2 — CID 111931131
2-[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]-N-propylacetamide;hydroiodide (PubChem CID 111931131) has the molecular formula C17H36IN5O2 and a molecular weight of 469.41 g/mol. Its IUPAC name is 2-[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]-N-propylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]-N-propylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111931131 |
| Molecular Formula | C17H36IN5O2 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]-N-propylacetamide;hydroiodide |
| SMILES | CCCNC(=O)C/N=C(\NCC)NCC(C(C)C)N1CCOCC1.I |
| InChI | InChI=1S/C17H35N5O2.HI/c1-5-7-19-16(23)13-21-17(18-6-2)20-12-15(14(3)4)22-8-10-24-11-9-22;/h14-15H,5-13H2,1-4H3,(H,19,23)(H2,18,20,21);1H |
| InChIKey | HUHNWLCUZNTJMA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|