C17H36IN5O2 — CID 111931725
3-[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111931725) has the molecular formula C17H36IN5O2 and a molecular weight of 469.41 g/mol. Its IUPAC name is 3-[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111931725 |
| Molecular Formula | C17H36IN5O2 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 3-[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NCC(C(C)C)N1CCOCC1.I |
| InChI | InChI=1S/C17H35N5O2.HI/c1-6-19-16(21-12-17(4,5)15(18)23)20-11-14(13(2)3)22-7-9-24-10-8-22;/h13-14H,6-12H2,1-5H3,(H2,18,23)(H2,19,20,21);1H |
| InChIKey | IRCBRARCNMCJIS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|