About [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate
[5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate (PubChem CID 86171784) has the molecular formula C8H6F3NO3
and a molecular weight of 221.13 g/mol. Its IUPAC name is [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate.
Molecular Properties
| Compound Name | [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate |
| PubChem CID | 86171784 |
| Molecular Formula | C8H6F3NO3 |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate |
| SMILES | O=C(CO)Oc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C8H6F3NO3/c9-8(10,11)5-1-2-6(12-3-5)15-7(14)4-13/h1-3,13H,4H2 |
| InChIKey | VKSMCTIWMRMDQQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate?
The IUPAC name of [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate (CID 86171784) is [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate.
What is the SMILES notation for [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate?
The canonical SMILES for [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate is O=C(CO)Oc1ccc(C(F)(F)F)cn1.
What is the InChIKey of [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate?
The InChIKey is VKSMCTIWMRMDQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO3/c9-8(10,11)5-1-2-6(12-3-5)15-7(14)4-13/h1-3,13H,4H2.
What are the key properties of [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate?
[5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate has a molecular weight of 221.13 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(trifluoromethyl)-2-pyridinyl] 2-hydroxyacetate is sourced from PubChem (CID 86171784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).