C12H17F3N2O2 — CID 143180631
ethane;2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide (PubChem CID 143180631) has the molecular formula C12H17F3N2O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is ethane;2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide.
| Compound Name | ethane;2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide |
|---|---|
| PubChem CID | 143180631 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | ethane;2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide |
| SMILES | CC.CC(C)(Oc1ccc(C(F)(F)F)cn1)C(N)=O |
| InChI | InChI=1S/C10H11F3N2O2.C2H6/c1-9(2,8(14)16)17-7-4-3-6(5-15-7)10(11,12)13;1-2/h3-5H,1-2H3,(H2,14,16);1-2H3 |
| InChIKey | WNZPCVPOOAUGGW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |