C23H28F3NO4 — CID 139807732
butyl 2-methyl-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]hexanoate (PubChem CID 139807732) has the molecular formula C23H28F3NO4 and a molecular weight of 439.47 g/mol. Its IUPAC name is butyl 2-methyl-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]hexanoate.
| Compound Name | butyl 2-methyl-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]hexanoate |
|---|---|
| PubChem CID | 139807732 |
| Molecular Formula | C23H28F3NO4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | butyl 2-methyl-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]hexanoate |
| SMILES | CCCCOC(=O)C(C)(CCCC)Oc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C23H28F3NO4/c1-4-6-14-22(3,21(28)29-15-7-5-2)31-19-11-9-18(10-12-19)30-20-13-8-17(16-27-20)23(24,25)26/h8-13,16H,4-7,14-15H2,1-3H3 |
| InChIKey | TXISNEFNQLQRTA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|