C17H18N2O6S3-2 — CID 58709343
4-[2-[2-(4-sulfonatophenyl)ethylcarbamothioylamino]ethyl]benzenesulfonate (PubChem CID 58709343) has the molecular formula C17H18N2O6S3-2 and a molecular weight of 442.54 g/mol. Its IUPAC name is 4-[2-[2-(4-sulfonatophenyl)ethylcarbamothioylamino]ethyl]benzenesulfonate.
| Compound Name | 4-[2-[2-(4-sulfonatophenyl)ethylcarbamothioylamino]ethyl]benzenesulfonate |
|---|---|
| PubChem CID | 58709343 |
| Molecular Formula | C17H18N2O6S3-2 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-[2-[2-(4-sulfonatophenyl)ethylcarbamothioylamino]ethyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(CCNC(=S)NCCc2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H20N2O6S3/c20-27(21,22)15-5-1-13(2-6-15)9-11-18-17(26)19-12-10-14-3-7-16(8-4-14)28(23,24)25/h1-8H,9-12H2,(H2,18,19,26)(H,20,21,22)(H,23,24,25)/p-2 |
| InChIKey | KRHYJKNDFXEHIF-UHFFFAOYSA-L |
| XLogP | 0.74 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|