C17H19N3O5S — CID 31172106
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 6-methylpyridine-3-carboxylate (PubChem CID 31172106) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 6-methylpyridine-3-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 6-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 31172106 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 6-methylpyridine-3-carboxylate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C17H19N3O5S/c1-12-2-5-14(10-20-12)17(22)25-11-16(21)19-9-8-13-3-6-15(7-4-13)26(18,23)24/h2-7,10H,8-9,11H2,1H3,(H,19,21)(H2,18,23,24) |
| InChIKey | OWJADNGYZWMXMX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |