C20H21N3O5S — CID 35192559
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2-methyl-1H-indole-3-carboxylate (PubChem CID 35192559) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2-methyl-1H-indole-3-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2-methyl-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 35192559 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2-methyl-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)OCC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H21N3O5S/c1-13-19(16-4-2-3-5-17(16)23-13)20(25)28-12-18(24)22-11-10-14-6-8-15(9-7-14)29(21,26)27/h2-9,23H,10-12H2,1H3,(H,22,24)(H2,21,26,27) |
| InChIKey | WDZGORJGMMACQW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |