C21H27N5O3 — CID 111166723
N-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111166723) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111166723 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(OCC2CC2)nc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-22-21(24-14-17-6-7-19(23-13-17)29-15-16-4-5-16)26-10-8-25(9-11-26)20(27)18-3-2-12-28-18/h2-3,6-7,12-13,16H,4-5,8-11,14-15H2,1H3,(H,22,24) |
| InChIKey | ZMGPLUONHIQLMO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|