C22H31IN4O3 — CID 111166776
N'-[2-(2,6-dimethylphenoxy)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111166776) has the molecular formula C22H31IN4O3 and a molecular weight of 526.42 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylphenoxy)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(2,6-dimethylphenoxy)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111166776 |
| Molecular Formula | C22H31IN4O3 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N'-[2-(2,6-dimethylphenoxy)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCOc1c(C)cccc1C)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C22H30N4O3.HI/c1-4-23-22(24-10-16-29-20-17(2)7-5-8-18(20)3)26-13-11-25(12-14-26)21(27)19-9-6-15-28-19;/h5-9,15H,4,10-14,16H2,1-3H3,(H,23,24);1H |
| InChIKey | GNEMAICHGPTNKA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|