C19H24BrIN4O2 — CID 111166542
N'-[(3-bromophenyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111166542) has the molecular formula C19H24BrIN4O2 and a molecular weight of 547.24 g/mol. Its IUPAC name is N'-[(3-bromophenyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(3-bromophenyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111166542 |
| Molecular Formula | C19H24BrIN4O2 |
| Molecular Weight | 547.24 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | N'-[(3-bromophenyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Br)c1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C19H23BrN4O2.HI/c1-2-21-19(22-14-15-5-3-6-16(20)13-15)24-10-8-23(9-11-24)18(25)17-7-4-12-26-17;/h3-7,12-13H,2,8-11,14H2,1H3,(H,21,22);1H |
| InChIKey | STAFNRCNGHJZQQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|