C21H29IN4O2 — CID 111168524
N'-[(2,4-dimethylphenyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111168524) has the molecular formula C21H29IN4O2 and a molecular weight of 496.39 g/mol. Its IUPAC name is N'-[(2,4-dimethylphenyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(2,4-dimethylphenyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111168524 |
| Molecular Formula | C21H29IN4O2 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N'-[(2,4-dimethylphenyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1C)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C21H28N4O2.HI/c1-4-22-21(23-15-18-8-7-16(2)14-17(18)3)25-11-9-24(10-12-25)20(26)19-6-5-13-27-19;/h5-8,13-14H,4,9-12,15H2,1-3H3,(H,22,23);1H |
| InChIKey | UPHMGEVWERIGKH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|