C20H25F2IN4O3 — CID 111167746
N'-[[2-(difluoromethoxy)phenyl]methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111167746) has the molecular formula C20H25F2IN4O3 and a molecular weight of 534.35 g/mol. Its IUPAC name is N'-[[2-(difluoromethoxy)phenyl]methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-(difluoromethoxy)phenyl]methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111167746 |
| Molecular Formula | C20H25F2IN4O3 |
| Molecular Weight | 534.35 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | N'-[[2-(difluoromethoxy)phenyl]methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)F)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C20H24F2N4O3.HI/c1-2-23-20(24-14-15-6-3-4-7-16(15)29-19(21)22)26-11-9-25(10-12-26)18(27)17-8-5-13-28-17;/h3-8,13,19H,2,9-12,14H2,1H3,(H,23,24);1H |
| InChIKey | IERLNVOZQOFYIQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|