C22H32IN5O3 — CID 111168324
N'-[(2-butoxy-3-pyridinyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111168324) has the molecular formula C22H32IN5O3 and a molecular weight of 541.43 g/mol. Its IUPAC name is N'-[(2-butoxy-3-pyridinyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(2-butoxy-3-pyridinyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111168324 |
| Molecular Formula | C22H32IN5O3 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | N'-[(2-butoxy-3-pyridinyl)methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCCOc1ncccc1C/N=C(\NCC)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C22H31N5O3.HI/c1-3-5-15-30-20-18(8-6-10-24-20)17-25-22(23-4-2)27-13-11-26(12-14-27)21(28)19-9-7-16-29-19;/h6-10,16H,3-5,11-15,17H2,1-2H3,(H,23,25);1H |
| InChIKey | KTBAZQUYQAUKOU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|