C20H24F3N5O3 — CID 111168163
N-ethyl-4-(furan-2-carbonyl)-N'-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide (PubChem CID 111168163) has the molecular formula C20H24F3N5O3 and a molecular weight of 439.44 g/mol. Its IUPAC name is N-ethyl-4-(furan-2-carbonyl)-N'-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(furan-2-carbonyl)-N'-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111168163 |
| Molecular Formula | C20H24F3N5O3 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-ethyl-4-(furan-2-carbonyl)-N'-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccnc1OCC(F)(F)F)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H24F3N5O3/c1-2-24-19(26-13-15-5-3-7-25-17(15)31-14-20(21,22)23)28-10-8-27(9-11-28)18(29)16-6-4-12-30-16/h3-7,12H,2,8-11,13-14H2,1H3,(H,24,26) |
| InChIKey | QPLDUWVHOCCJDX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|