C19H24F2N6O — CID 111205820
N'-[[2-(difluoromethoxy)phenyl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111205820) has the molecular formula C19H24F2N6O and a molecular weight of 390.44 g/mol. Its IUPAC name is N'-[[2-(difluoromethoxy)phenyl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[[2-(difluoromethoxy)phenyl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111205820 |
| Molecular Formula | C19H24F2N6O |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N'-[[2-(difluoromethoxy)phenyl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)F)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H24F2N6O/c1-2-22-18(25-14-15-6-3-4-7-16(15)28-17(20)21)26-10-12-27(13-11-26)19-23-8-5-9-24-19/h3-9,17H,2,10-14H2,1H3,(H,22,25) |
| InChIKey | JEZCAXMBVCAUPE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|