C19H25N3 — CID 110955638
N-ethyl-N'-(2-naphthalen-2-ylethyl)pyrrolidine-1-carboximidamide (PubChem CID 110955638) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is N-ethyl-N'-(2-naphthalen-2-ylethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-naphthalen-2-ylethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110955638 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N-ethyl-N'-(2-naphthalen-2-ylethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccc2ccccc2c1)N1CCCC1 |
| InChI | InChI=1S/C19H25N3/c1-2-20-19(22-13-5-6-14-22)21-12-11-16-9-10-17-7-3-4-8-18(17)15-16/h3-4,7-10,15H,2,5-6,11-14H2,1H3,(H,20,21) |
| InChIKey | QPAHAOJYUZERCI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|