C22H32IN7O2 — CID 111205915
2-[3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111205915) has the molecular formula C22H32IN7O2 and a molecular weight of 553.45 g/mol. Its IUPAC name is 2-[3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111205915 |
| Molecular Formula | C22H32IN7O2 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-[3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(=O)N(C)C)c1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C22H31N7O2.HI/c1-4-23-21(28-11-13-29(14-12-28)22-24-9-6-10-25-22)26-16-18-7-5-8-19(15-18)31-17-20(30)27(2)3;/h5-10,15H,4,11-14,16-17H2,1-3H3,(H,23,26);1H |
| InChIKey | BUPAUQVBIVPCII-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|