C23H34IN7O — CID 111206449
N-butan-2-yl-3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111206449) has the molecular formula C23H34IN7O and a molecular weight of 551.48 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111206449 |
| Molecular Formula | C23H34IN7O |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | N-butan-2-yl-3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C23H33N7O.HI/c1-4-18(3)28-21(31)20-9-6-8-19(16-20)17-27-22(24-5-2)29-12-14-30(15-13-29)23-25-10-7-11-26-23;/h6-11,16,18H,4-5,12-15,17H2,1-3H3,(H,24,27)(H,28,31);1H |
| InChIKey | XGIFVHVTHOVVMN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|