C22H28N6O2 — CID 111208044
N-ethyl-N'-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111208044) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N-ethyl-N'-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111208044 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-ethyl-N'-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | C#CCOc1cc(C/N=C(\NCC)N2CCN(c3ncccn3)CC2)ccc1OC |
| InChI | InChI=1S/C22H28N6O2/c1-4-15-30-20-16-18(7-8-19(20)29-3)17-26-21(23-5-2)27-11-13-28(14-12-27)22-24-9-6-10-25-22/h1,6-10,16H,5,11-15,17H2,2-3H3,(H,23,26) |
| InChIKey | XPMJKOGPFGSMDP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|