C22H28ClN5O2 — CID 111357464
2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(4-hydroxyphenyl)acetamide (PubChem CID 111357464) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 111357464 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(O)cc1)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H28ClN5O2/c1-2-24-22(25-15-21(30)26-19-6-8-20(29)9-7-19)28-12-10-27(11-13-28)16-17-4-3-5-18(23)14-17/h3-9,14,29H,2,10-13,15-16H2,1H3,(H,24,25)(H,26,30) |
| InChIKey | MXJBFCKBDHNKKV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|