C21H27FIN5O2 — CID 111165300
2-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide (PubChem CID 111165300) has the molecular formula C21H27FIN5O2 and a molecular weight of 527.38 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111165300 |
| Molecular Formula | C21H27FIN5O2 |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 2-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(O)cc1)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C21H26FN5O2.HI/c1-2-23-21(24-15-20(29)25-17-5-9-19(28)10-6-17)27-13-11-26(12-14-27)18-7-3-16(22)4-8-18;/h3-10,28H,2,11-15H2,1H3,(H,23,24)(H,25,29);1H |
| InChIKey | RQANWMZFPLEZQJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|