C19H28FIN4O — CID 109443772
2-[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 109443772) has the molecular formula C19H28FIN4O and a molecular weight of 474.36 g/mol. Its IUPAC name is 2-[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109443772 |
| Molecular Formula | C19H28FIN4O |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2-[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)cc1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C19H27FN4O.HI/c1-2-21-19(24-12-14-5-3-4-6-15(14)13-24)22-11-18(25)23-17-9-7-16(20)8-10-17;/h7-10,14-15H,2-6,11-13H2,1H3,(H,21,22)(H,23,25);1H |
| InChIKey | LJCOSPDBQIDXSD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|