C20H33ClIN5O — CID 111357465
N-[2-[[C-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111357465) has the molecular formula C20H33ClIN5O and a molecular weight of 521.88 g/mol. Its IUPAC name is N-[2-[[C-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[C-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111357465 |
| Molecular Formula | C20H33ClIN5O |
| Molecular Weight | 521.88 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | N-[2-[[C-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)N1CCN(Cc2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C20H32ClN5O.HI/c1-20(2,3)18(27)23-8-9-24-19(22-4)26-12-10-25(11-13-26)15-16-6-5-7-17(21)14-16;/h5-7,14H,8-13,15H2,1-4H3,(H,22,24)(H,23,27);1H |
| InChIKey | LBJZKGHFTJWYGC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.88 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|