C19H26FIN4O — CID 109402812
1-[(3-fluoro-4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide (PubChem CID 109402812) has the molecular formula C19H26FIN4O and a molecular weight of 472.35 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109402812 |
| Molecular Formula | C19H26FIN4O |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccncc1C)N(C)Cc1ccc(OC)c(F)c1.I |
| InChI | InChI=1S/C19H25FN4O.HI/c1-14-12-22-9-7-16(14)8-10-23-19(21-2)24(3)13-15-5-6-18(25-4)17(20)11-15;/h5-7,9,11-12H,8,10,13H2,1-4H3,(H,21,23);1H |
| InChIKey | MARYRGHEOBRBHH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|