C19H26N4 — CID 109402108
1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine (PubChem CID 109402108) has the molecular formula C19H26N4 and a molecular weight of 310.45 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109402108 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1ccncc1C)N(C)Cc1ccccc1C |
| InChI | InChI=1S/C19H26N4/c1-15-7-5-6-8-18(15)14-23(4)19(20-3)22-12-10-17-9-11-21-13-16(17)2/h5-9,11,13H,10,12,14H2,1-4H3,(H,20,22) |
| InChIKey | RXFAIZLHFZVPQK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|